C49H36LaN4O2-2 — CID 139247176
(Z)-4-hydroxypent-3-en-2-one;lanthanum;5,10,15,20-tetraphenylporphyrin-22,24-diide (PubChem CID 139247176) has the molecular formula C49H36LaN4O2-2 and a molecular weight of 851.76 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;lanthanum;5,10,15,20-tetraphenylporphyrin-22,24-diide.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;lanthanum;5,10,15,20-tetraphenylporphyrin-22,24-diide |
|---|---|
| PubChem CID | 139247176 |
| Molecular Formula | C49H36LaN4O2-2 |
| Molecular Weight | 851.76 g/mol |
| Exact Mass | 851.19 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;lanthanum;5,10,15,20-tetraphenylporphyrin-22,24-diide |
| SMILES | C1=Cc2nc1c(-c1ccccc1)c1ccc([n-]1)c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([n-]3)c2-c2ccccc2)C=C1.CC(=O)/C=C(/C)O.[La] |
| InChI | InChI=1S/C44H28N4.C5H8O2.La/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36;1-4(6)3-5(2)7;/h1-28H;3,6H,1-2H3;/q-2;;/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-;4-3-; |
| InChIKey | XQYJVEPCWXANTM-WPAGPEGWSA-N |
| XLogP | 11.62 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.76 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|