C43H30N4NiO2 — CID 25229252
methyl (E)-4-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)but-2-enoate;nickel(2+) (PubChem CID 25229252) has the molecular formula C43H30N4NiO2 and a molecular weight of 693.43 g/mol. Its IUPAC name is methyl (E)-4-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)but-2-enoate;nickel(2+).
| Compound Name | methyl (E)-4-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)but-2-enoate;nickel(2+) |
|---|---|
| PubChem CID | 25229252 |
| Molecular Formula | C43H30N4NiO2 |
| Molecular Weight | 693.43 g/mol |
| Exact Mass | 692.17 |
| IUPAC Name | methyl (E)-4-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)but-2-enoate;nickel(2+) |
| SMILES | COC(=O)/C=C/Cc1c2nc(c(-c3ccccc3)c3ccc([n-]3)c(-c3ccccc3)c3nc(c(-c4ccccc4)c4ccc1[n-]4)C=C3)C=C2.[Ni+2] |
| InChI | InChI=1S/C43H30N4O2.Ni/c1-49-40(48)19-11-18-31-32-20-22-34(44-32)41(28-12-5-2-6-13-28)36-24-26-38(46-36)43(30-16-9-4-10-17-30)39-27-25-37(47-39)42(29-14-7-3-8-15-29)35-23-21-33(31)45-35;/h2-17,19-27H,18H2,1H3;/q-2;+2/b19-11+,32-31-,33-31-,41-34-,41-36-,42-35-,42-37-,43-38-,43-39-; |
| InChIKey | HVQCVRFOYADLDZ-CLIIFWPJSA-N |
| XLogP | 9.18 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.43 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|