C46H30AuN4O2-2 — CID 162468799
gold;methyl 4-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)benzoate (PubChem CID 162468799) has the molecular formula C46H30AuN4O2-2 and a molecular weight of 867.74 g/mol. Its IUPAC name is gold;methyl 4-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)benzoate.
| Compound Name | gold;methyl 4-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)benzoate |
|---|---|
| PubChem CID | 162468799 |
| Molecular Formula | C46H30AuN4O2-2 |
| Molecular Weight | 867.74 g/mol |
| Exact Mass | 867.20 |
| IUPAC Name | gold;methyl 4-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)benzoate |
| SMILES | COC(=O)c1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([n-]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[n-]5)C=C4)C=C3)cc1.[Au] |
| InChI | InChI=1S/C46H31N4O2.Au/c1-52-46(51)33-19-17-32(18-20-33)45-40-27-25-38(49-40)43(30-13-7-3-8-14-30)36-23-21-34(47-36)42(29-11-5-2-6-12-29)35-22-24-37(48-35)44(31-15-9-4-10-16-31)39-26-28-41(45)50-39;/h2-28H,1H3,(H-,47,48,49,50,51);/q-1;/p-1/b42-34-,42-35-,43-36-,43-38-,44-37-,44-39-,45-40-,45-41-; |
| InChIKey | PNZXYLNAXQPAMA-RORYYHOOSA-M |
| XLogP | 10.37 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.74 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |