C48H32N6 — CID 136776317
3-[15-(3-cyanophenyl)-10,20-bis(4-methylphenyl)-21,23-dihydroporphyrin-5-yl]benzonitrile (PubChem CID 136776317) has the molecular formula C48H32N6 and a molecular weight of 692.83 g/mol. Its IUPAC name is 3-[15-(3-cyanophenyl)-10,20-bis(4-methylphenyl)-21,23-dihydroporphyrin-5-yl]benzonitrile.
| Compound Name | 3-[15-(3-cyanophenyl)-10,20-bis(4-methylphenyl)-21,23-dihydroporphyrin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 136776317 |
| Molecular Formula | C48H32N6 |
| Molecular Weight | 692.83 g/mol |
| Exact Mass | 692.27 |
| IUPAC Name | 3-[15-(3-cyanophenyl)-10,20-bis(4-methylphenyl)-21,23-dihydroporphyrin-5-yl]benzonitrile |
| SMILES | Cc1ccc(-c2c3nc(c(-c4cccc(C#N)c4)c4ccc([nH]4)c(-c4ccc(C)cc4)c4nc(c(-c5cccc(C#N)c5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C48H32N6/c1-29-9-13-33(14-10-29)45-37-17-21-41(51-37)47(35-7-3-5-31(25-35)27-49)43-23-19-39(53-43)46(34-15-11-30(2)12-16-34)40-20-24-44(54-40)48(42-22-18-38(45)52-42)36-8-4-6-32(26-36)28-50/h3-26,51,54H,1-2H3/b45-37-,45-38-,46-39-,46-40-,47-41-,47-43-,48-42-,48-44- |
| InChIKey | RYSOPEHBURIXEU-ZNSTUQKDSA-N |
| XLogP | 11.68 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.83 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |