C52H30N4 — CID 136707552
5,10,15,20-tetrakis(3-ethynylphenyl)-21,23-dihydroporphyrin (PubChem CID 136707552) has the molecular formula C52H30N4 and a molecular weight of 710.84 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(3-ethynylphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(3-ethynylphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136707552 |
| Molecular Formula | C52H30N4 |
| Molecular Weight | 710.84 g/mol |
| Exact Mass | 710.25 |
| IUPAC Name | 5,10,15,20-tetrakis(3-ethynylphenyl)-21,23-dihydroporphyrin |
| SMILES | C#Cc1cccc(-c2c3nc(c(-c4cccc(C#C)c4)c4ccc([nH]4)c(-c4cccc(C#C)c4)c4nc(c(-c5cccc(C#C)c5)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C52H30N4/c1-5-33-13-9-17-37(29-33)49-41-21-23-43(53-41)50(38-18-10-14-34(6-2)30-38)45-25-27-47(55-45)52(40-20-12-16-36(8-4)32-40)48-28-26-46(56-48)51(44-24-22-42(49)54-44)39-19-11-15-35(7-3)31-39/h1-4,9-32,53,56H/b49-41-,49-42-,50-43-,50-45-,51-44-,51-46-,52-47-,52-48- |
| InChIKey | JGRNPIXHJKBMQV-RCOMQYLTSA-N |
| XLogP | 11.25 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.84 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|