C40H28N5+ — CID 101333369
15-[2-(1-methylpyridin-1-ium-2-yl)ethynyl]-10,20-diphenyl-21,22-dihydroporphyrin (PubChem CID 101333369) has the molecular formula C40H28N5+ and a molecular weight of 578.70 g/mol. Its IUPAC name is 15-[2-(1-methylpyridin-1-ium-2-yl)ethynyl]-10,20-diphenyl-21,22-dihydroporphyrin.
| Compound Name | 15-[2-(1-methylpyridin-1-ium-2-yl)ethynyl]-10,20-diphenyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 101333369 |
| Molecular Formula | C40H28N5+ |
| Molecular Weight | 578.70 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | 15-[2-(1-methylpyridin-1-ium-2-yl)ethynyl]-10,20-diphenyl-21,22-dihydroporphyrin |
| SMILES | C[n+]1ccccc1C#Cc1c2nc(c(-c3ccccc3)c3ccc(cc4ccc([nH]4)c(-c4ccccc4)c4nc1C=C4)[nH]3)C=C2 |
| InChI | InChI=1S/C40H27N5/c1-45-25-9-8-14-31(45)17-18-32-33-21-23-37(43-33)39(27-10-4-2-5-11-27)35-19-15-29(41-35)26-30-16-20-36(42-30)40(28-12-6-3-7-13-28)38-24-22-34(32)44-38/h2-16,19-26H,1H3,(H,41,42,43,44)/p+1 |
| InChIKey | WLPWDMGLCGGCPA-UHFFFAOYSA-O |
| XLogP | 8.21 |
| TPSA | 61.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.70 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|