C34H25N5O2 — CID 11364625
methyl N-(10,20-diphenyl-23,24-dihydroporphyrin-5-yl)carbamate (PubChem CID 11364625) has the molecular formula C34H25N5O2 and a molecular weight of 535.61 g/mol. Its IUPAC name is methyl N-(10,20-diphenyl-23,24-dihydroporphyrin-5-yl)carbamate.
| Compound Name | methyl N-(10,20-diphenyl-23,24-dihydroporphyrin-5-yl)carbamate |
|---|---|
| PubChem CID | 11364625 |
| Molecular Formula | C34H25N5O2 |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | methyl N-(10,20-diphenyl-23,24-dihydroporphyrin-5-yl)carbamate |
| SMILES | COC(=O)Nc1c2nc(c(-c3ccccc3)c3ccc(cc4ccc([nH]4)c(-c4ccccc4)c4nc1C=C4)[nH]3)C=C2 |
| InChI | InChI=1S/C34H25N5O2/c1-41-34(40)39-33-29-18-16-27(37-29)31(21-8-4-2-5-9-21)25-14-12-23(35-25)20-24-13-15-26(36-24)32(22-10-6-3-7-11-22)28-17-19-30(33)38-28/h2-20,35-36H,1H3,(H,39,40)/b23-20-,24-20-,31-25-,31-27-,32-26-,32-28-,33-29+,33-30+ |
| InChIKey | PAXZWLATPPTNMY-HPDWPLKISA-N |
| XLogP | 8.17 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |