C45H32N4 — CID 10031928
2-methyl-5,10,15,20-tetraphenyl-21,22-dihydroporphyrin (PubChem CID 10031928) has the molecular formula C45H32N4 and a molecular weight of 628.78 g/mol. Its IUPAC name is 2-methyl-5,10,15,20-tetraphenyl-21,22-dihydroporphyrin.
| Compound Name | 2-methyl-5,10,15,20-tetraphenyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 10031928 |
| Molecular Formula | C45H32N4 |
| Molecular Weight | 628.78 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | 2-methyl-5,10,15,20-tetraphenyl-21,22-dihydroporphyrin |
| SMILES | Cc1cc2[nH]c1c(-c1ccccc1)c1nc(c(-c3ccccc3)c3nc(c(-c4ccccc4)c4ccc([nH]4)c2-c2ccccc2)C=C3)C=C1 |
| InChI | InChI=1S/C45H32N4/c1-29-28-40-43(32-18-10-4-11-19-32)38-25-24-36(47-38)41(30-14-6-2-7-15-30)34-22-23-35(46-34)42(31-16-8-3-9-17-31)37-26-27-39(48-37)44(45(29)49-40)33-20-12-5-13-21-33/h2-28,47,49H,1H3/b41-34-,41-36-,42-35-,42-37-,43-38-,43-40-,44-39-,45-44- |
| InChIKey | YNZACAQZZXAJBL-WRBHSUHOSA-N |
| XLogP | 11.63 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.78 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |