C38H15BrF10N4 — CID 136777623
5-bromo-10,20-bis(2,3,4,5,6-pentafluorophenyl)-15-phenyl-21,23-dihydroporphyrin (PubChem CID 136777623) has the molecular formula C38H15BrF10N4 and a molecular weight of 797.45 g/mol. Its IUPAC name is 5-bromo-10,20-bis(2,3,4,5,6-pentafluorophenyl)-15-phenyl-21,23-dihydroporphyrin.
| Compound Name | 5-bromo-10,20-bis(2,3,4,5,6-pentafluorophenyl)-15-phenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136777623 |
| Molecular Formula | C38H15BrF10N4 |
| Molecular Weight | 797.45 g/mol |
| Exact Mass | 796.03 |
| IUPAC Name | 5-bromo-10,20-bis(2,3,4,5,6-pentafluorophenyl)-15-phenyl-21,23-dihydroporphyrin |
| SMILES | Fc1c(F)c(F)c(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4c(F)c(F)c(F)c(F)c4F)c4nc(c(Br)c5ccc2[nH]5)C=C4)C=C3)c(F)c1F |
| InChI | InChI=1S/C38H15BrF10N4/c39-28-21-12-10-19(52-21)24(26-29(40)33(44)37(48)34(45)30(26)41)17-8-6-15(50-17)23(14-4-2-1-3-5-14)16-7-9-18(51-16)25(20-11-13-22(28)53-20)27-31(42)35(46)38(49)36(47)32(27)43/h1-13,50,53H/b23-15-,23-16-,24-17+,24-19+,25-18+,25-20+,28-21+,28-22+ |
| InChIKey | BSTAMGFUQDJJTG-FGBIWGHCSA-N |
| XLogP | 11.81 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.45 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|