C49H38N4O — CID 136824553
5,10,15,20-tetrakis(4-methylphenyl)-21,23-dihydroporphyrin-2-carbaldehyde (PubChem CID 136824553) has the molecular formula C49H38N4O and a molecular weight of 698.87 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(4-methylphenyl)-21,23-dihydroporphyrin-2-carbaldehyde.
| Compound Name | 5,10,15,20-tetrakis(4-methylphenyl)-21,23-dihydroporphyrin-2-carbaldehyde |
|---|---|
| PubChem CID | 136824553 |
| Molecular Formula | C49H38N4O |
| Molecular Weight | 698.87 g/mol |
| Exact Mass | 698.30 |
| IUPAC Name | 5,10,15,20-tetrakis(4-methylphenyl)-21,23-dihydroporphyrin-2-carbaldehyde |
| SMILES | Cc1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4cc(C=O)c([nH]4)c(-c4ccc(C)cc4)c4nc(c(-c5ccc(C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C49H38N4O/c1-29-5-13-33(14-6-29)45-38-21-22-39(50-38)46(34-15-7-30(2)8-16-34)41-25-26-43(52-41)48(36-19-11-32(4)12-20-36)49-37(28-54)27-44(53-49)47(42-24-23-40(45)51-42)35-17-9-31(3)10-18-35/h5-28,50,53H,1-4H3/b45-38-,45-40-,46-39-,46-41-,47-42-,47-44-,48-43-,49-48- |
| InChIKey | SKEBFFBCBYDYSR-AWUUXPGOSA-N |
| XLogP | 12.37 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.87 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|