C55H42N6O3 — CID 177447278
5-[(Z)-3-[5,10,15,20-tetrakis(4-methylphenyl)-21,23-dihydroporphyrin-2-yl]prop-2-enylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 177447278) has the molecular formula C55H42N6O3 and a molecular weight of 834.98 g/mol. Its IUPAC name is 5-[(Z)-3-[5,10,15,20-tetrakis(4-methylphenyl)-21,23-dihydroporphyrin-2-yl]prop-2-enylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(Z)-3-[5,10,15,20-tetrakis(4-methylphenyl)-21,23-dihydroporphyrin-2-yl]prop-2-enylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 177447278 |
| Molecular Formula | C55H42N6O3 |
| Molecular Weight | 834.98 g/mol |
| Exact Mass | 834.33 |
| IUPAC Name | 5-[(Z)-3-[5,10,15,20-tetrakis(4-methylphenyl)-21,23-dihydroporphyrin-2-yl]prop-2-enylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4cc(/C=C\C=C5C(=O)NC(=O)NC5=O)c([nH]4)c(-c4ccc(C)cc4)c4nc(c(-c5ccc(C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C55H42N6O3/c1-31-8-16-35(17-9-31)48-41-24-25-42(56-41)49(36-18-10-32(2)11-19-36)44-28-29-46(58-44)51(38-22-14-34(4)15-23-38)52-39(6-5-7-40-53(62)60-55(64)61-54(40)63)30-47(59-52)50(45-27-26-43(48)57-45)37-20-12-33(3)13-21-37/h5-30,56,59H,1-4H3,(H2,60,61,62,63,64)/b6-5-,48-41-,48-43-,49-42-,49-44-,50-45-,50-47-,51-46-,52-51- |
| InChIKey | LOPRHKKGQVWWNF-OPFAEHERSA-N |
| XLogP | 11.86 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.98 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|