C39H30N4O2 — CID 136754012
10,20-bis(4-methylphenyl)-15-[(E)-3-oxobut-1-enyl]-21,23-dihydroporphyrin-5-carbaldehyde (PubChem CID 136754012) has the molecular formula C39H30N4O2 and a molecular weight of 586.70 g/mol. Its IUPAC name is 10,20-bis(4-methylphenyl)-15-[(E)-3-oxobut-1-enyl]-21,23-dihydroporphyrin-5-carbaldehyde.
| Compound Name | 10,20-bis(4-methylphenyl)-15-[(E)-3-oxobut-1-enyl]-21,23-dihydroporphyrin-5-carbaldehyde |
|---|---|
| PubChem CID | 136754012 |
| Molecular Formula | C39H30N4O2 |
| Molecular Weight | 586.70 g/mol |
| Exact Mass | 586.24 |
| IUPAC Name | 10,20-bis(4-methylphenyl)-15-[(E)-3-oxobut-1-enyl]-21,23-dihydroporphyrin-5-carbaldehyde |
| SMILES | CC(=O)/C=C/c1c2nc(c(-c3ccc(C)cc3)c3ccc([nH]3)c(C=O)c3nc(c(-c4ccc(C)cc4)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C39H30N4O2/c1-23-4-9-26(10-5-23)38-34-18-14-30(40-34)28(13-8-25(3)45)31-15-19-35(41-31)39(27-11-6-24(2)7-12-27)37-21-17-33(43-37)29(22-44)32-16-20-36(38)42-32/h4-22,40,43H,1-3H3/b13-8+,30-28-,31-28-,32-29-,33-29-,38-34-,38-36-,39-35-,39-37- |
| InChIKey | HFBJISRLHVUCFL-PBSQNUFCSA-N |
| XLogP | 9.02 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.70 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|