C50H48N4O — CID 135423412
10,20-bis(4-tert-butylphenyl)-15-(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-carbaldehyde (PubChem CID 135423412) has the molecular formula C50H48N4O and a molecular weight of 720.96 g/mol. Its IUPAC name is 10,20-bis(4-tert-butylphenyl)-15-(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-carbaldehyde.
| Compound Name | 10,20-bis(4-tert-butylphenyl)-15-(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-carbaldehyde |
|---|---|
| PubChem CID | 135423412 |
| Molecular Formula | C50H48N4O |
| Molecular Weight | 720.96 g/mol |
| Exact Mass | 720.38 |
| IUPAC Name | 10,20-bis(4-tert-butylphenyl)-15-(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-carbaldehyde |
| SMILES | Cc1cc(C)c(-c2c3nc(c(-c4ccc(C(C)(C)C)cc4)c4ccc([nH]4)c(C=O)c4nc(c(-c5ccc(C(C)(C)C)cc5)c5ccc2[nH]5)C=C4)C=C3)c(C)c1 |
| InChI | InChI=1S/C50H48N4O/c1-29-26-30(2)45(31(3)27-29)48-43-24-22-41(53-43)46(32-10-14-34(15-11-32)49(4,5)6)39-20-18-37(51-39)36(28-55)38-19-21-40(52-38)47(42-23-25-44(48)54-42)33-12-16-35(17-13-33)50(7,8)9/h10-28,51,54H,1-9H3/b37-36-,38-36-,46-39-,46-41-,47-40-,47-42-,48-43+,48-44+ |
| InChIKey | WSFRLWVXMXDDEI-VDXFTVNJSA-N |
| XLogP | 12.99 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.96 |
| LogP ≤ 5 | 12.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|