C63H58N4O2 — CID 102339268
4-[4-[10,15,20-tris(4-tert-butylphenyl)-21,22-dihydroporphyrin-5-yl]phenoxy]benzaldehyde (PubChem CID 102339268) has the molecular formula C63H58N4O2 and a molecular weight of 903.18 g/mol. Its IUPAC name is 4-[4-[10,15,20-tris(4-tert-butylphenyl)-21,22-dihydroporphyrin-5-yl]phenoxy]benzaldehyde.
| Compound Name | 4-[4-[10,15,20-tris(4-tert-butylphenyl)-21,22-dihydroporphyrin-5-yl]phenoxy]benzaldehyde |
|---|---|
| PubChem CID | 102339268 |
| Molecular Formula | C63H58N4O2 |
| Molecular Weight | 903.18 g/mol |
| Exact Mass | 902.46 |
| IUPAC Name | 4-[4-[10,15,20-tris(4-tert-butylphenyl)-21,22-dihydroporphyrin-5-yl]phenoxy]benzaldehyde |
| SMILES | CC(C)(C)c1ccc(-c2c3nc(c(-c4ccc(C(C)(C)C)cc4)c4ccc([nH]4)c(-c4ccc(Oc5ccc(C=O)cc5)cc4)c4ccc([nH]4)c(-c4ccc(C(C)(C)C)cc4)c4nc2C=C4)C=C3)cc1 |
| InChI | InChI=1S/C63H58N4O2/c1-61(2,3)44-20-12-40(13-21-44)57-49-30-32-51(64-49)58(41-14-22-45(23-15-41)62(4,5)6)53-34-36-55(66-53)60(43-18-28-48(29-19-43)69-47-26-10-39(38-68)11-27-47)56-37-35-54(67-56)59(52-33-31-50(57)65-52)42-16-24-46(25-17-42)63(7,8)9/h10-38,66-67H,1-9H3/b57-49-,57-50-,58-51-,58-53-,59-52-,59-54-,60-55-,60-56- |
| InChIKey | QXAPIGFPMAGESF-NWQHMXIBSA-N |
| XLogP | 16.82 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.18 |
| LogP ≤ 5 | 16.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|