C48H31N5O2 — CID 136722397
9-nitro-2,7,12,17-tetraphenyl-25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1,3(28),4,6,8,10,12,14,16(26),17,19,21,23-tridecaene (PubChem CID 136722397) has the molecular formula C48H31N5O2 and a molecular weight of 709.81 g/mol. Its IUPAC name is 9-nitro-2,7,12,17-tetraphenyl-25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1,3(28),4,6,8,10,12,14,16(26),17,19,21,23-tridecaene.
| Compound Name | 9-nitro-2,7,12,17-tetraphenyl-25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1,3(28),4,6,8,10,12,14,16(26),17,19,21,23-tridecaene |
|---|---|
| PubChem CID | 136722397 |
| Molecular Formula | C48H31N5O2 |
| Molecular Weight | 709.81 g/mol |
| Exact Mass | 709.25 |
| IUPAC Name | 9-nitro-2,7,12,17-tetraphenyl-25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1,3(28),4,6,8,10,12,14,16(26),17,19,21,23-tridecaene |
| SMILES | O=[N+]([O-])c1cc2[nH]c1c(-c1ccccc1)c1nc(c(-c3ccccc3)c3[nH]c(c(-c4ccccc4)c4nc(c2-c2ccccc2)C=C4)c2ccccc32)C=C1 |
| InChI | InChI=1S/C48H31N5O2/c54-53(55)41-29-40-42(30-15-5-1-6-16-30)36-25-26-37(49-36)43(31-17-7-2-8-18-31)46-34-23-13-14-24-35(34)47(52-46)44(32-19-9-3-10-20-32)38-27-28-39(50-38)45(48(41)51-40)33-21-11-4-12-22-33/h1-29,51-52H/b42-36-,42-40-,43-37-,44-38-,45-39-,46-43-,47-44-,48-45- |
| InChIKey | DUFWFFJSHVUYBR-CFIALIKXSA-N |
| XLogP | 12.39 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.81 |
| LogP ≤ 5 | 12.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|