C68H45N5O2 — CID 132547396
7-nitro-2,3,5,10,12,13,15,20-octakis-phenyl-21,23-dihydroporphyrin (PubChem CID 132547396) has the molecular formula C68H45N5O2 and a molecular weight of 964.14 g/mol. Its IUPAC name is 7-nitro-2,3,5,10,12,13,15,20-octakis-phenyl-21,23-dihydroporphyrin.
| Compound Name | 7-nitro-2,3,5,10,12,13,15,20-octakis-phenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 132547396 |
| Molecular Formula | C68H45N5O2 |
| Molecular Weight | 964.14 g/mol |
| Exact Mass | 963.36 |
| IUPAC Name | 7-nitro-2,3,5,10,12,13,15,20-octakis-phenyl-21,23-dihydroporphyrin |
| SMILES | O=[N+]([O-])C1=Cc2nc1c(-c1ccccc1)c1[nH]c(c(-c3ccccc3)c3nc(c(-c4ccccc4)c4[nH]c(c2-c2ccccc2)c(-c2ccccc2)c4-c2ccccc2)C=C3)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C68H45N5O2/c74-73(75)55-43-54-58(46-29-13-3-14-30-46)67-60(48-33-17-5-18-34-48)59(47-31-15-4-16-32-47)65(71-67)56(44-25-9-1-10-26-44)52-41-42-53(69-52)57(45-27-11-2-12-28-45)66-61(49-35-19-6-20-36-49)62(50-37-21-7-22-38-50)68(72-66)63(64(55)70-54)51-39-23-8-24-40-51/h1-43,71-72H/b56-52-,57-53-,58-54-,64-63-,65-56-,66-57-,67-58-,68-63- |
| InChIKey | PWMZAQVPQIHKHW-NPYKWNHKSA-N |
| XLogP | 17.60 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 964.14 |
| LogP ≤ 5 | 17.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|