C44H25Cl4N5O2 — CID 135855104
5,10,15,20-tetrakis(4-chlorophenyl)-12-nitro-21,22-dihydroporphyrin (PubChem CID 135855104) has the molecular formula C44H25Cl4N5O2 and a molecular weight of 797.53 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(4-chlorophenyl)-12-nitro-21,22-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(4-chlorophenyl)-12-nitro-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 135855104 |
| Molecular Formula | C44H25Cl4N5O2 |
| Molecular Weight | 797.53 g/mol |
| Exact Mass | 795.08 |
| IUPAC Name | 5,10,15,20-tetrakis(4-chlorophenyl)-12-nitro-21,22-dihydroporphyrin |
| SMILES | O=[N+]([O-])C1=Cc2nc1c(-c1ccc(Cl)cc1)c1ccc([nH]1)c(-c1ccc(Cl)cc1)c1ccc([nH]1)c(-c1ccc(Cl)cc1)c1nc(c2-c2ccc(Cl)cc2)C=C1 |
| InChI | InChI=1S/C44H25Cl4N5O2/c45-28-9-1-24(2-10-28)40-32-17-18-33(49-32)41(25-3-11-29(46)12-4-25)35-21-22-37(51-35)43(27-7-15-31(48)16-8-27)44-39(53(54)55)23-38(52-44)42(36-20-19-34(40)50-36)26-5-13-30(47)14-6-26/h1-23,49,51H/b40-32-,40-34-,41-33-,41-35-,42-36-,42-38-,43-37-,44-43- |
| InChIKey | HHBSOQACEKXJLE-KZAHNQLSSA-N |
| XLogP | 13.54 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.53 |
| LogP ≤ 5 | 13.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|