C76H91N5O4 — CID 177458544
5,10,15,20-tetrakis(3,5-ditert-butylphenyl)-12-nitro-22,24-dihydroporphyrin-2,3-dione (PubChem CID 177458544) has the molecular formula C76H91N5O4 and a molecular weight of 1138.59 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(3,5-ditert-butylphenyl)-12-nitro-22,24-dihydroporphyrin-2,3-dione.
| Compound Name | 5,10,15,20-tetrakis(3,5-ditert-butylphenyl)-12-nitro-22,24-dihydroporphyrin-2,3-dione |
|---|---|
| PubChem CID | 177458544 |
| Molecular Formula | C76H91N5O4 |
| Molecular Weight | 1138.59 g/mol |
| Exact Mass | 1137.71 |
| IUPAC Name | 5,10,15,20-tetrakis(3,5-ditert-butylphenyl)-12-nitro-22,24-dihydroporphyrin-2,3-dione |
| SMILES | CC(C)(C)c1cc(-c2c3nc(c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4ccc([nH]4)c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4nc(c(-c5cc(C(C)(C)C)cc(C(C)(C)C)c5)c5ccc2[nH]5)C(=O)C4=O)C([N+](=O)[O-])=C3)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C76H91N5O4/c1-69(2,3)46-29-42(30-47(37-46)70(4,5)6)60-54-25-26-56(77-54)62(44-33-50(73(13,14)15)39-51(34-44)74(16,17)18)65-67(82)68(83)66(80-65)63(45-35-52(75(19,20)21)40-53(36-45)76(22,23)24)57-28-27-55(78-57)61(64-59(81(84)85)41-58(60)79-64)43-31-48(71(7,8)9)38-49(32-43)72(10,11)12/h25-41,77-78H,1-24H3/b60-54-,60-58-,61-55-,62-56-,63-57-,64-61-,65-62-,66-63- |
| InChIKey | GYWIRLFZFFIICU-JOXQSPTQSA-N |
| XLogP | 20.20 |
| TPSA | 134.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1138.59 |
| LogP ≤ 5 | 20.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|