C50H31N9O2 — CID 136738928
2-[(2S,3S)-3-(dicyanomethyl)-13-nitro-5,10,15,20-tetraphenyl-2,3,22,24-tetrahydroporphyrin-2-yl]propanedinitrile (PubChem CID 136738928) has the molecular formula C50H31N9O2 and a molecular weight of 789.86 g/mol. Its IUPAC name is 2-[(2S,3S)-3-(dicyanomethyl)-13-nitro-5,10,15,20-tetraphenyl-2,3,22,24-tetrahydroporphyrin-2-yl]propanedinitrile.
| Compound Name | 2-[(2S,3S)-3-(dicyanomethyl)-13-nitro-5,10,15,20-tetraphenyl-2,3,22,24-tetrahydroporphyrin-2-yl]propanedinitrile |
|---|---|
| PubChem CID | 136738928 |
| Molecular Formula | C50H31N9O2 |
| Molecular Weight | 789.86 g/mol |
| Exact Mass | 789.26 |
| IUPAC Name | 2-[(2S,3S)-3-(dicyanomethyl)-13-nitro-5,10,15,20-tetraphenyl-2,3,22,24-tetrahydroporphyrin-2-yl]propanedinitrile |
| SMILES | N#CC(C#N)[C@H]1c2nc(c(-c3ccccc3)c3ccc([nH]3)c(-c3ccccc3)c3nc(c(-c4ccccc4)c4ccc([nH]4)c2-c2ccccc2)C=C3[N+](=O)[O-])[C@@H]1C(C#N)C#N |
| InChI | InChI=1S/C50H31N9O2/c51-26-34(27-52)46-47(35(28-53)29-54)50-45(33-19-11-4-12-20-33)39-24-23-37(56-39)43(31-15-7-2-8-16-31)48-41(59(60)61)25-40(57-48)42(30-13-5-1-6-14-30)36-21-22-38(55-36)44(49(46)58-50)32-17-9-3-10-18-32/h1-25,34-35,46-47,55-56H/b42-36-,42-40-,43-37-,44-38-,45-39-,48-43-,49-44-,50-45-/t46-,47-/m1/s1 |
| InChIKey | NQCCGVUSHLRVEX-FBFFIUBTSA-N |
| XLogP | 10.95 |
| TPSA | 195.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.86 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|