C48H26N8 — CID 15303294
5,10,15,20-tetraphenyl-22,24-dihydroporphyrin-2,3,12,13-tetracarbonitrile (PubChem CID 15303294) has the molecular formula C48H26N8 and a molecular weight of 714.79 g/mol. Its IUPAC name is 5,10,15,20-tetraphenyl-22,24-dihydroporphyrin-2,3,12,13-tetracarbonitrile.
| Compound Name | 5,10,15,20-tetraphenyl-22,24-dihydroporphyrin-2,3,12,13-tetracarbonitrile |
|---|---|
| PubChem CID | 15303294 |
| Molecular Formula | C48H26N8 |
| Molecular Weight | 714.79 g/mol |
| Exact Mass | 714.23 |
| IUPAC Name | 5,10,15,20-tetraphenyl-22,24-dihydroporphyrin-2,3,12,13-tetracarbonitrile |
| SMILES | N#CC1=C(C#N)c2nc1c(-c1ccccc1)c1ccc([nH]1)c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([nH]3)c2-c2ccccc2)C(C#N)=C1C#N |
| InChI | InChI=1S/C48H26N8/c49-25-33-34(26-50)46-43(31-17-9-3-10-18-31)39-23-24-40(54-39)44(32-19-11-4-12-20-32)48-36(28-52)35(27-51)47(56-48)42(30-15-7-2-8-16-30)38-22-21-37(53-38)41(45(33)55-46)29-13-5-1-6-14-29/h1-24,53-54H/b41-37-,42-38-,43-39-,44-40-,45-41-,46-43-,47-42-,48-44- |
| InChIKey | FADFKUXVDULYHP-VVBZUZIESA-N |
| XLogP | 10.90 |
| TPSA | 152.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.79 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |