C47H30N6 — CID 11966846
(19S,21R)-2,7,12,17-tetraphenyl-22,23,24,25-tetrazahexacyclo[16.3.1.13,6.18,11.113,16.019,21]pentacosa-1(22),2,4,6,8(24),9,11,13,15,17-decaene-20,20-dicarbonitrile (PubChem CID 11966846) has the molecular formula C47H30N6 and a molecular weight of 678.80 g/mol. Its IUPAC name is (19S,21R)-2,7,12,17-tetraphenyl-22,23,24,25-tetrazahexacyclo[16.3.1.13,6.18,11.113,16.019,21]pentacosa-1(22),2,4,6,8(24),9,11,13,15,17-decaene-20,20-dicarbonitrile.
| Compound Name | (19S,21R)-2,7,12,17-tetraphenyl-22,23,24,25-tetrazahexacyclo[16.3.1.13,6.18,11.113,16.019,21]pentacosa-1(22),2,4,6,8(24),9,11,13,15,17-decaene-20,20-dicarbonitrile |
|---|---|
| PubChem CID | 11966846 |
| Molecular Formula | C47H30N6 |
| Molecular Weight | 678.80 g/mol |
| Exact Mass | 678.25 |
| IUPAC Name | (19S,21R)-2,7,12,17-tetraphenyl-22,23,24,25-tetrazahexacyclo[16.3.1.13,6.18,11.113,16.019,21]pentacosa-1(22),2,4,6,8(24),9,11,13,15,17-decaene-20,20-dicarbonitrile |
| SMILES | N#CC1(C#N)[C@@H]2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc([nH]5)c3-c3ccccc3)C=C4)[C@@H]21 |
| InChI | InChI=1S/C47H30N6/c48-27-47(28-49)43-44(47)46-42(32-19-11-4-12-20-32)38-26-24-36(52-38)40(30-15-7-2-8-16-30)34-22-21-33(50-34)39(29-13-5-1-6-14-29)35-23-25-37(51-35)41(45(43)53-46)31-17-9-3-10-18-31/h1-26,43-44,51-52H/b39-33-,39-35-,40-34-,40-36-,41-37-,42-38-,45-41-,46-42-/t43-,44+ |
| InChIKey | KEBFARYLHPFZME-DFTRPCDLSA-N |
| XLogP | 11.07 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.80 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |