C50H32N8 — CID 141291986
2-[3-(dicyanomethyl)-5,10,15,20-tetraphenyl-2,3,21,23-tetrahydroporphyrin-2-yl]propanedinitrile (PubChem CID 141291986) has the molecular formula C50H32N8 and a molecular weight of 744.86 g/mol. Its IUPAC name is 2-[3-(dicyanomethyl)-5,10,15,20-tetraphenyl-2,3,21,23-tetrahydroporphyrin-2-yl]propanedinitrile.
| Compound Name | 2-[3-(dicyanomethyl)-5,10,15,20-tetraphenyl-2,3,21,23-tetrahydroporphyrin-2-yl]propanedinitrile |
|---|---|
| PubChem CID | 141291986 |
| Molecular Formula | C50H32N8 |
| Molecular Weight | 744.86 g/mol |
| Exact Mass | 744.27 |
| IUPAC Name | 2-[3-(dicyanomethyl)-5,10,15,20-tetraphenyl-2,3,21,23-tetrahydroporphyrin-2-yl]propanedinitrile |
| SMILES | N#CC(C#N)C1c2[nH]c(c(-c3ccccc3)c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c2-c2ccccc2)C=C4)C=C3)C1C(C#N)C#N |
| InChI | InChI=1S/C50H32N8/c51-27-35(28-52)47-48(36(29-53)30-54)50-46(34-19-11-4-12-20-34)42-26-24-40(57-42)44(32-15-7-2-8-16-32)38-22-21-37(55-38)43(31-13-5-1-6-14-31)39-23-25-41(56-39)45(49(47)58-50)33-17-9-3-10-18-33/h1-26,35-36,47-48,55,58H/b43-39-,44-40-,49-45-,50-46- |
| InChIKey | XDPTWNDIVXNVFV-VFWVJJSPSA-N |
| XLogP | 11.24 |
| TPSA | 152.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.86 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |