C48H37N5O6 — CID 135480454
5,10,15,20-tetrakis(3-methoxyphenyl)-7-nitro-21,23-dihydroporphyrin (PubChem CID 135480454) has the molecular formula C48H37N5O6 and a molecular weight of 779.85 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(3-methoxyphenyl)-7-nitro-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(3-methoxyphenyl)-7-nitro-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135480454 |
| Molecular Formula | C48H37N5O6 |
| Molecular Weight | 779.85 g/mol |
| Exact Mass | 779.27 |
| IUPAC Name | 5,10,15,20-tetrakis(3-methoxyphenyl)-7-nitro-21,23-dihydroporphyrin |
| SMILES | COc1cccc(-c2c3nc(c(-c4cccc(OC)c4)c4ccc([nH]4)c(-c4cccc(OC)c4)c4nc(c(-c5cccc(OC)c5)c5ccc2[nH]5)C=C4[N+](=O)[O-])C=C3)c1 |
| InChI | InChI=1S/C48H37N5O6/c1-56-32-13-5-9-28(23-32)44-36-17-18-37(49-36)45(29-10-6-14-33(24-29)57-2)39-21-22-41(51-39)47(31-12-8-16-35(26-31)59-4)48-43(53(54)55)27-42(52-48)46(40-20-19-38(44)50-40)30-11-7-15-34(25-30)58-3/h5-27,50-51H,1-4H3/b44-36-,44-38-,45-37-,45-39-,46-40-,46-42-,47-41-,48-47- |
| InChIKey | ULIATOPLCQLCDK-ZDMNOSTMSA-N |
| XLogP | 10.96 |
| TPSA | 137.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.85 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|