C48H39N5 — CID 135855105
5,10,15,20-tetrakis(4-methylphenyl)-23,24-dihydroporphyrin-2-amine (PubChem CID 135855105) has the molecular formula C48H39N5 and a molecular weight of 685.88 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(4-methylphenyl)-23,24-dihydroporphyrin-2-amine.
| Compound Name | 5,10,15,20-tetrakis(4-methylphenyl)-23,24-dihydroporphyrin-2-amine |
|---|---|
| PubChem CID | 135855105 |
| Molecular Formula | C48H39N5 |
| Molecular Weight | 685.88 g/mol |
| Exact Mass | 685.32 |
| IUPAC Name | 5,10,15,20-tetrakis(4-methylphenyl)-23,24-dihydroporphyrin-2-amine |
| SMILES | Cc1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4ccc([nH]4)c(-c4ccc(C)cc4)c4ccc([nH]4)c(-c4ccc(C)cc4)c4nc2C=C4N)C=C3)cc1 |
| InChI | InChI=1S/C48H39N5/c1-28-5-13-32(14-6-28)44-37-21-22-38(50-37)45(33-15-7-29(2)8-16-33)40-25-26-42(52-40)47(35-19-11-31(4)12-20-35)48-36(49)27-43(53-48)46(41-24-23-39(44)51-41)34-17-9-30(3)10-18-34/h5-27,50,52H,49H2,1-4H3/b44-37-,44-39-,45-38-,45-40-,46-41-,46-43-,47-42-,48-47- |
| InChIKey | QUWDBBFQFDLORO-DOCADPJRSA-N |
| XLogP | 11.84 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.88 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |