C80H54N4 — CID 101343804
2,3,5,7,8,10,12,13,15,20-decakis-phenyl-21,23-dihydroporphyrin (PubChem CID 101343804) has the molecular formula C80H54N4 and a molecular weight of 1071.34 g/mol. Its IUPAC name is 2,3,5,7,8,10,12,13,15,20-decakis-phenyl-21,23-dihydroporphyrin.
| Compound Name | 2,3,5,7,8,10,12,13,15,20-decakis-phenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 101343804 |
| Molecular Formula | C80H54N4 |
| Molecular Weight | 1071.34 g/mol |
| Exact Mass | 1070.43 |
| IUPAC Name | 2,3,5,7,8,10,12,13,15,20-decakis-phenyl-21,23-dihydroporphyrin |
| SMILES | C1=Cc2nc1c(-c1ccccc1)c1[nH]c(c(-c3ccccc3)c3nc(c(-c4ccccc4)c4[nH]c(c2-c2ccccc2)c(-c2ccccc2)c4-c2ccccc2)C(c2ccccc2)=C3c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C80H54N4/c1-11-31-53(32-12-1)65-63-51-52-64(81-63)66(54-33-13-2-14-34-54)76-68(56-37-17-4-18-38-56)70(58-41-21-6-22-42-58)78(83-76)74(62-49-29-10-30-50-62)80-72(60-45-25-8-26-46-60)71(59-43-23-7-24-44-59)79(84-80)73(61-47-27-9-28-48-61)77-69(57-39-19-5-20-40-57)67(75(65)82-77)55-35-15-3-16-36-55/h1-52,82-83H/b65-63-,66-64-,75-65-,76-66-,77-73-,78-74-,79-73-,80-74- |
| InChIKey | NDQQFRKFNFPDLU-HRTOQFAASA-N |
| XLogP | 20.83 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1071.34 |
| LogP ≤ 5 | 20.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|