C80H70N4 — CID 101014025
2,3,12,13-tetraphenyl-5,10,15,20-tetrakis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin (PubChem CID 101014025) has the molecular formula C80H70N4 and a molecular weight of 1087.47 g/mol. Its IUPAC name is 2,3,12,13-tetraphenyl-5,10,15,20-tetrakis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin.
| Compound Name | 2,3,12,13-tetraphenyl-5,10,15,20-tetrakis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 101014025 |
| Molecular Formula | C80H70N4 |
| Molecular Weight | 1087.47 g/mol |
| Exact Mass | 1086.56 |
| IUPAC Name | 2,3,12,13-tetraphenyl-5,10,15,20-tetrakis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin |
| SMILES | Cc1cc(C)c(-c2c3nc(c(-c4c(C)cc(C)cc4C)c4[nH]c(c(-c5c(C)cc(C)cc5C)c5nc(c(-c6c(C)cc(C)cc6C)c6[nH]c2c(-c2ccccc2)c6-c2ccccc2)C=C5)c(-c2ccccc2)c4-c2ccccc2)C=C3)c(C)c1 |
| InChI | InChI=1S/C80H70N4/c1-45-37-49(5)65(50(6)38-45)73-61-33-34-62(81-61)74(66-51(7)39-46(2)40-52(66)8)79-71(59-29-21-15-22-30-59)72(60-31-23-16-24-32-60)80(84-79)76(68-55(11)43-48(4)44-56(68)12)64-36-35-63(82-64)75(67-53(9)41-47(3)42-54(67)10)78-70(58-27-19-14-20-28-58)69(77(73)83-78)57-25-17-13-18-26-57/h13-44,83-84H,1-12H3/b73-61-,74-62-,75-63-,76-64-,77-73+,78-75+,79-74+,80-76+ |
| InChIKey | DZEMCSJLZGSRGF-RPHJPDNGSA-N |
| XLogP | 21.69 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1087.47 |
| LogP ≤ 5 | 21.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |