C52H33N5O2S2 — CID 136710959
12-nitro-5,10,15,20-tetraphenyl-2,3-dithiophen-2-yl-21,23-dihydroporphyrin (PubChem CID 136710959) has the molecular formula C52H33N5O2S2 and a molecular weight of 824.00 g/mol. Its IUPAC name is 12-nitro-5,10,15,20-tetraphenyl-2,3-dithiophen-2-yl-21,23-dihydroporphyrin.
| Compound Name | 12-nitro-5,10,15,20-tetraphenyl-2,3-dithiophen-2-yl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136710959 |
| Molecular Formula | C52H33N5O2S2 |
| Molecular Weight | 824.00 g/mol |
| Exact Mass | 823.21 |
| IUPAC Name | 12-nitro-5,10,15,20-tetraphenyl-2,3-dithiophen-2-yl-21,23-dihydroporphyrin |
| SMILES | O=[N+]([O-])c1cc2[nH]c1c(-c1ccccc1)c1nc(c(-c3ccccc3)c3[nH]c(c(-c4ccccc4)c4nc(c2-c2ccccc2)C=C4)c(-c2cccs2)c3-c2cccs2)C=C1 |
| InChI | InChI=1S/C52H33N5O2S2/c58-57(59)41-31-40-44(32-15-5-1-6-16-32)36-25-26-38(53-36)46(34-19-9-3-10-20-34)51-48(42-23-13-29-60-42)49(43-24-14-30-61-43)52(56-51)47(35-21-11-4-12-22-35)39-28-27-37(54-39)45(50(41)55-40)33-17-7-2-8-18-33/h1-31,55-56H/b44-36-,44-40-,45-37-,46-38-,47-39-,50-45-,51-46-,52-47- |
| InChIKey | DMNPVWFVVOMXHU-GWYIROIOSA-N |
| XLogP | 14.69 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.00 |
| LogP ≤ 5 | 14.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|