C37H23N7O6 — CID 136835247
5,10,15-tris(2-nitrophenyl)-22,23-dihydro-21H-corrin (PubChem CID 136835247) has the molecular formula C37H23N7O6 and a molecular weight of 661.63 g/mol. Its IUPAC name is 5,10,15-tris(2-nitrophenyl)-22,23-dihydro-21H-corrin.
| Compound Name | 5,10,15-tris(2-nitrophenyl)-22,23-dihydro-21H-corrin |
|---|---|
| PubChem CID | 136835247 |
| Molecular Formula | C37H23N7O6 |
| Molecular Weight | 661.63 g/mol |
| Exact Mass | 661.17 |
| IUPAC Name | 5,10,15-tris(2-nitrophenyl)-22,23-dihydro-21H-corrin |
| SMILES | O=[N+]([O-])c1ccccc1-c1c2nc(c3ccc([nH]3)c(-c3ccccc3[N+](=O)[O-])c3ccc([nH]3)c(-c3ccccc3[N+](=O)[O-])c3ccc1[nH]3)C=C2 |
| InChI | InChI=1S/C37H23N7O6/c45-42(46)32-10-4-1-7-21(32)35-26-15-13-24(38-26)25-14-16-27(39-25)36(22-8-2-5-11-33(22)43(47)48)29-18-20-31(41-29)37(30-19-17-28(35)40-30)23-9-3-6-12-34(23)44(49)50/h1-20,38,40-41H/b25-24-,35-26-,35-28-,36-27-,36-29-,37-30-,37-31- |
| InChIKey | RHAIMQYKCAWNAY-VJCWWXEVSA-N |
| XLogP | 9.42 |
| TPSA | 189.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.63 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|