C52H50N4S4+4 — CID 136749684
dimethyl-[2-[10,15,20-tris(2-dimethylsulfoniophenyl)-21,23-dihydroporphyrin-5-yl]phenyl]sulfanium (PubChem CID 136749684) has the molecular formula C52H50N4S4+4 and a molecular weight of 859.27 g/mol. Its IUPAC name is dimethyl-[2-[10,15,20-tris(2-dimethylsulfoniophenyl)-21,23-dihydroporphyrin-5-yl]phenyl]sulfanium.
| Compound Name | dimethyl-[2-[10,15,20-tris(2-dimethylsulfoniophenyl)-21,23-dihydroporphyrin-5-yl]phenyl]sulfanium |
|---|---|
| PubChem CID | 136749684 |
| Molecular Formula | C52H50N4S4+4 |
| Molecular Weight | 859.27 g/mol |
| Exact Mass | 858.29 |
| IUPAC Name | dimethyl-[2-[10,15,20-tris(2-dimethylsulfoniophenyl)-21,23-dihydroporphyrin-5-yl]phenyl]sulfanium |
| SMILES | C[S+](C)c1ccccc1-c1c2nc(c(-c3ccccc3[S+](C)C)c3ccc([nH]3)c(-c3ccccc3[S+](C)C)c3nc(c(-c4ccccc4[S+](C)C)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C52H50N4S4/c1-57(2)45-21-13-9-17-33(45)49-37-25-27-39(53-37)50(34-18-10-14-22-46(34)58(3)4)41-29-31-43(55-41)52(36-20-12-16-24-48(36)60(7)8)44-32-30-42(56-44)51(40-28-26-38(49)54-40)35-19-11-15-23-47(35)59(5)6/h9-32,53,56H,1-8H3/q+4/b49-37-,49-38-,50-39-,50-41-,51-40-,51-42-,52-43-,52-44- |
| InChIKey | GFIPNTTZIYYKMM-QURNHSOUSA-N |
| XLogP | 12.27 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.27 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|