C24H15N3O4 — CID 129277402
3,6-bis(2-nitrophenyl)-9H-carbazole (PubChem CID 129277402) has the molecular formula C24H15N3O4 and a molecular weight of 409.40 g/mol. Its IUPAC name is 3,6-bis(2-nitrophenyl)-9H-carbazole.
| Compound Name | 3,6-bis(2-nitrophenyl)-9H-carbazole |
|---|---|
| PubChem CID | 129277402 |
| Molecular Formula | C24H15N3O4 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 3,6-bis(2-nitrophenyl)-9H-carbazole |
| SMILES | O=[N+]([O-])c1ccccc1-c1ccc2[nH]c3ccc(-c4ccccc4[N+](=O)[O-])cc3c2c1 |
| InChI | InChI=1S/C24H15N3O4/c28-26(29)23-7-3-1-5-17(23)15-9-11-21-19(13-15)20-14-16(10-12-22(20)25-21)18-6-2-4-8-24(18)27(30)31/h1-14,25H |
| InChIKey | ZNOVPBUGCLLPEH-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 102.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|