C60H50N8O12 — CID 102386285
4-oxo-4-[4-[10,15,20-tris[4-(3-carboxypropanoylamino)phenyl]-21,23-dihydroporphyrin-5-yl]anilino]butanoic acid (PubChem CID 102386285) has the molecular formula C60H50N8O12 and a molecular weight of 1075.10 g/mol. Its IUPAC name is 4-oxo-4-[4-[10,15,20-tris[4-(3-carboxypropanoylamino)phenyl]-21,23-dihydroporphyrin-5-yl]anilino]butanoic acid.
| Compound Name | 4-oxo-4-[4-[10,15,20-tris[4-(3-carboxypropanoylamino)phenyl]-21,23-dihydroporphyrin-5-yl]anilino]butanoic acid |
|---|---|
| PubChem CID | 102386285 |
| Molecular Formula | C60H50N8O12 |
| Molecular Weight | 1075.10 g/mol |
| Exact Mass | 1074.35 |
| IUPAC Name | 4-oxo-4-[4-[10,15,20-tris[4-(3-carboxypropanoylamino)phenyl]-21,23-dihydroporphyrin-5-yl]anilino]butanoic acid |
| SMILES | O=C(O)CCC(=O)Nc1ccc(-c2c3nc(c(-c4ccc(NC(=O)CCC(=O)O)cc4)c4ccc([nH]4)c(-c4ccc(NC(=O)CCC(=O)O)cc4)c4nc(c(-c5ccc(NC(=O)CCC(=O)O)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C60H50N8O12/c69-49(25-29-53(73)74)61-37-9-1-33(2-10-37)57-41-17-19-43(65-41)58(34-3-11-38(12-4-34)62-50(70)26-30-54(75)76)45-21-23-47(67-45)60(36-7-15-40(16-8-36)64-52(72)28-32-56(79)80)48-24-22-46(68-48)59(44-20-18-42(57)66-44)35-5-13-39(14-6-35)63-51(71)27-31-55(77)78/h1-24,65,68H,25-32H2,(H,61,69)(H,62,70)(H,63,71)(H,64,72)(H,73,74)(H,75,76)(H,77,78)(H,79,80)/b57-41-,57-42-,58-43-,58-45-,59-44-,59-46-,60-47-,60-48- |
| InChIKey | DJAUVFIPSALPNQ-BDQRUJJPSA-N |
| XLogP | 10.54 |
| TPSA | 322.96 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1075.10 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |