C54H46N6O5 — CID 136805897
ethyl 2-[(2-ethoxy-2-oxoethyl)-[2-oxo-2-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)anilino]ethyl]amino]acetate (PubChem CID 136805897) has the molecular formula C54H46N6O5 and a molecular weight of 859.00 g/mol. Its IUPAC name is ethyl 2-[(2-ethoxy-2-oxoethyl)-[2-oxo-2-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)anilino]ethyl]amino]acetate.
| Compound Name | ethyl 2-[(2-ethoxy-2-oxoethyl)-[2-oxo-2-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)anilino]ethyl]amino]acetate |
|---|---|
| PubChem CID | 136805897 |
| Molecular Formula | C54H46N6O5 |
| Molecular Weight | 859.00 g/mol |
| Exact Mass | 858.35 |
| IUPAC Name | ethyl 2-[(2-ethoxy-2-oxoethyl)-[2-oxo-2-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)anilino]ethyl]amino]acetate |
| SMILES | CCOC(=O)CN(CC(=O)Nc1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1)CC(=O)OCC |
| InChI | InChI=1S/C54H46N6O5/c1-3-64-49(62)33-60(34-50(63)65-4-2)32-48(61)55-39-22-20-38(21-23-39)54-46-30-28-44(58-46)52(36-16-10-6-11-17-36)42-26-24-40(56-42)51(35-14-8-5-9-15-35)41-25-27-43(57-41)53(37-18-12-7-13-19-37)45-29-31-47(54)59-45/h5-31,56,59H,3-4,32-34H2,1-2H3,(H,55,61)/b51-40-,51-41-,52-42-,52-44-,53-43-,53-45-,54-46-,54-47- |
| InChIKey | OXZNTNNDVNYOLS-LGJSZTJXSA-N |
| XLogP | 10.69 |
| TPSA | 142.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.00 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |