C48H36N4O2 — CID 136810706
ethyl 2-(5,10,15,20-tetraphenyl-22,24-dihydroporphyrin-2-yl)acetate (PubChem CID 136810706) has the molecular formula C48H36N4O2 and a molecular weight of 700.84 g/mol. Its IUPAC name is ethyl 2-(5,10,15,20-tetraphenyl-22,24-dihydroporphyrin-2-yl)acetate.
| Compound Name | ethyl 2-(5,10,15,20-tetraphenyl-22,24-dihydroporphyrin-2-yl)acetate |
|---|---|
| PubChem CID | 136810706 |
| Molecular Formula | C48H36N4O2 |
| Molecular Weight | 700.84 g/mol |
| Exact Mass | 700.28 |
| IUPAC Name | ethyl 2-(5,10,15,20-tetraphenyl-22,24-dihydroporphyrin-2-yl)acetate |
| SMILES | CCOC(=O)CC1=Cc2nc1c(-c1ccccc1)c1ccc([nH]1)c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([nH]3)c2-c2ccccc2)C=C1 |
| InChI | InChI=1S/C48H36N4O2/c1-2-54-43(53)30-35-29-42-46(33-19-11-5-12-20-33)40-26-25-38(50-40)44(31-15-7-3-8-16-31)36-23-24-37(49-36)45(32-17-9-4-10-18-32)39-27-28-41(51-39)47(48(35)52-42)34-21-13-6-14-22-34/h3-29,50-51H,2,30H2,1H3/b44-36-,44-38-,45-37-,45-39-,46-40-,46-42-,47-41-,48-47- |
| InChIKey | MYQCZAUSRSPOMW-ZDMNOSTMSA-N |
| XLogP | 11.65 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.84 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |