C56H54N8O8+4 — CID 135484195
ethyl 2-[2-[10,15,20-tris[1-(2-ethoxy-2-oxoethyl)pyridin-1-ium-2-yl]-21,23-dihydroporphyrin-5-yl]pyridin-1-ium-1-yl]acetate (PubChem CID 135484195) has the molecular formula C56H54N8O8+4 and a molecular weight of 967.10 g/mol. Its IUPAC name is ethyl 2-[2-[10,15,20-tris[1-(2-ethoxy-2-oxoethyl)pyridin-1-ium-2-yl]-21,23-dihydroporphyrin-5-yl]pyridin-1-ium-1-yl]acetate.
| Compound Name | ethyl 2-[2-[10,15,20-tris[1-(2-ethoxy-2-oxoethyl)pyridin-1-ium-2-yl]-21,23-dihydroporphyrin-5-yl]pyridin-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 135484195 |
| Molecular Formula | C56H54N8O8+4 |
| Molecular Weight | 967.10 g/mol |
| Exact Mass | 966.40 |
| IUPAC Name | ethyl 2-[2-[10,15,20-tris[1-(2-ethoxy-2-oxoethyl)pyridin-1-ium-2-yl]-21,23-dihydroporphyrin-5-yl]pyridin-1-ium-1-yl]acetate |
| SMILES | CCOC(=O)C[n+]1ccccc1-c1c2nc(c(-c3cccc[n+]3CC(=O)OCC)c3ccc([nH]3)c(-c3cccc[n+]3CC(=O)OCC)c3nc(c(-c4cccc[n+]4CC(=O)OCC)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C56H53N8O8/c1-5-69-49(65)33-61-29-13-9-17-45(61)53-37-21-23-39(57-37)54(46-18-10-14-30-62(46)34-50(66)70-6-2)41-25-27-43(59-41)56(48-20-12-16-32-64(48)36-52(68)72-8-4)44-28-26-42(60-44)55(40-24-22-38(53)58-40)47-19-11-15-31-63(47)35-51(67)71-7-3/h9-32H,5-8,33-36H2,1-4H3,(H,57,58,59,60)/q+3/p+1/b53-37+,53-38+,54-39+,54-41+,55-40+,55-42+,56-43+,56-44+ |
| InChIKey | QTENRSYXEDYOIM-UBNDZAPISA-O |
| XLogP | 6.73 |
| TPSA | 178.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.10 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|