C48H34F12MnN8+6 — CID 135873916
manganese(2+);5,10,15,20-tetrakis[1-(2,2,2-trifluoroethyl)pyridin-1-ium-2-yl]-21,23-dihydroporphyrin (PubChem CID 135873916) has the molecular formula C48H34F12MnN8+6 and a molecular weight of 1005.77 g/mol. Its IUPAC name is manganese(2+);5,10,15,20-tetrakis[1-(2,2,2-trifluoroethyl)pyridin-1-ium-2-yl]-21,23-dihydroporphyrin.
| Compound Name | manganese(2+);5,10,15,20-tetrakis[1-(2,2,2-trifluoroethyl)pyridin-1-ium-2-yl]-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135873916 |
| Molecular Formula | C48H34F12MnN8+6 |
| Molecular Weight | 1005.77 g/mol |
| Exact Mass | 1005.21 |
| IUPAC Name | manganese(2+);5,10,15,20-tetrakis[1-(2,2,2-trifluoroethyl)pyridin-1-ium-2-yl]-21,23-dihydroporphyrin |
| SMILES | FC(F)(F)C[n+]1ccccc1-c1c2nc(c(-c3cccc[n+]3CC(F)(F)F)c3ccc([nH]3)c(-c3cccc[n+]3CC(F)(F)F)c3nc(c(-c4cccc[n+]4CC(F)(F)F)c4ccc1[nH]4)C=C3)C=C2.[Mn+2] |
| InChI | InChI=1S/C48H33F12N8.Mn/c49-45(50,51)25-65-21-5-1-9-37(65)41-29-13-15-31(61-29)42(38-10-2-6-22-66(38)26-46(52,53)54)33-17-19-35(63-33)44(40-12-4-8-24-68(40)28-48(58,59)60)36-20-18-34(64-36)43(32-16-14-30(41)62-32)39-11-3-7-23-67(39)27-47(55,56)57;/h1-24H,25-28H2,(H,61,62,63,64);/q+3;+2/p+1/b41-29+,41-30+,42-31+,42-33+,43-32+,43-34+,44-35+,44-36+; |
| InChIKey | VEPZWWCHGKEKID-AQZHRKEBSA-O |
| XLogP | 10.72 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1005.77 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|