C52H54N8O4+4 — CID 135953384
5,10,15-tris[1-(2-methoxyethyl)pyridin-1-ium-2-yl]-20-[1-(2-methoxyethyl)pyridin-1-ium-3-yl]-21,23-dihydroporphyrin (PubChem CID 135953384) has the molecular formula C52H54N8O4+4 and a molecular weight of 855.06 g/mol. Its IUPAC name is 5,10,15-tris[1-(2-methoxyethyl)pyridin-1-ium-2-yl]-20-[1-(2-methoxyethyl)pyridin-1-ium-3-yl]-21,23-dihydroporphyrin.
| Compound Name | 5,10,15-tris[1-(2-methoxyethyl)pyridin-1-ium-2-yl]-20-[1-(2-methoxyethyl)pyridin-1-ium-3-yl]-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135953384 |
| Molecular Formula | C52H54N8O4+4 |
| Molecular Weight | 855.06 g/mol |
| Exact Mass | 854.42 |
| IUPAC Name | 5,10,15-tris[1-(2-methoxyethyl)pyridin-1-ium-2-yl]-20-[1-(2-methoxyethyl)pyridin-1-ium-3-yl]-21,23-dihydroporphyrin |
| SMILES | COCC[n+]1cccc(-c2c3nc(c(-c4cccc[n+]4CCOC)c4ccc([nH]4)c(-c4cccc[n+]4CCOC)c4nc(c(-c5cccc[n+]5CCOC)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C52H53N8O4/c1-61-32-28-57-24-11-12-37(36-57)49-38-16-18-40(53-38)50(46-13-5-8-25-58(46)29-33-62-2)42-20-22-44(55-42)52(48-15-7-10-27-60(48)31-35-64-4)45-23-21-43(56-45)51(41-19-17-39(49)54-41)47-14-6-9-26-59(47)30-34-63-3/h5-27,36H,28-35H2,1-4H3,(H,53,54,55,56)/q+3/p+1/b49-38-,49-39-,50-40+,50-42+,51-41+,51-43+,52-44+,52-45+ |
| InChIKey | YENSUKCTGJONRK-FTUYCDAJSA-O |
| XLogP | 7.06 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.06 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|