C60H62N8+4 — CID 10534386
5,10,15,20-tetrakis(1-pent-4-enylpyridin-1-ium-3-yl)-21,22-dihydroporphyrin (PubChem CID 10534386) has the molecular formula C60H62N8+4 and a molecular weight of 895.21 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(1-pent-4-enylpyridin-1-ium-3-yl)-21,22-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(1-pent-4-enylpyridin-1-ium-3-yl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 10534386 |
| Molecular Formula | C60H62N8+4 |
| Molecular Weight | 895.21 g/mol |
| Exact Mass | 894.51 |
| IUPAC Name | 5,10,15,20-tetrakis(1-pent-4-enylpyridin-1-ium-3-yl)-21,22-dihydroporphyrin |
| SMILES | C=CCCC[n+]1cccc(-c2c3nc(c(-c4ccc[n+](CCCC=C)c4)c4ccc([nH]4)c(-c4ccc[n+](CCCC=C)c4)c4ccc([nH]4)c(-c4ccc[n+](CCCC=C)c4)c4nc2C=C4)C=C3)c1 |
| InChI | InChI=1S/C60H62N8/c1-5-9-13-33-65-37-17-21-45(41-65)57-49-25-27-51(61-49)58(46-22-18-38-66(42-46)34-14-10-6-2)53-29-31-55(63-53)60(48-24-20-40-68(44-48)36-16-12-8-4)56-32-30-54(64-56)59(52-28-26-50(57)62-52)47-23-19-39-67(43-47)35-15-11-7-3/h5-8,17-32,37-44,61-62H,1-4,9-16,33-36H2/q+4/b57-49-,57-50-,58-51-,58-53-,59-52-,59-54-,60-55-,60-56- |
| InChIKey | PQFOPGPFUPKFNZ-NWQHMXIBSA-N |
| XLogP | 12.34 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.21 |
| LogP ≤ 5 | 12.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|