C48H46N8+4 — CID 135415934
5,10,15,20-tetrakis(1-ethylpyridin-1-ium-2-yl)-21,23-dihydroporphyrin (PubChem CID 135415934) has the molecular formula C48H46N8+4 and a molecular weight of 734.95 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(1-ethylpyridin-1-ium-2-yl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(1-ethylpyridin-1-ium-2-yl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135415934 |
| Molecular Formula | C48H46N8+4 |
| Molecular Weight | 734.95 g/mol |
| Exact Mass | 734.38 |
| IUPAC Name | 5,10,15,20-tetrakis(1-ethylpyridin-1-ium-2-yl)-21,23-dihydroporphyrin |
| SMILES | CC[n+]1ccccc1-c1c2nc(c(-c3cccc[n+]3CC)c3ccc([nH]3)c(-c3cccc[n+]3CC)c3nc(c(-c4cccc[n+]4CC)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C48H45N8/c1-5-53-29-13-9-17-41(53)45-33-21-23-35(49-33)46(42-18-10-14-30-54(42)6-2)37-25-27-39(51-37)48(44-20-12-16-32-56(44)8-4)40-28-26-38(52-40)47(36-24-22-34(45)50-36)43-19-11-15-31-55(43)7-3/h9-32H,5-8H2,1-4H3,(H,49,50,51,52)/q+3/p+1/b45-33+,45-34+,46-35+,46-37+,47-36+,47-38+,48-39+,48-40+ |
| InChIKey | VISGTQUNEUWKFP-KOMVAUQLSA-O |
| XLogP | 8.55 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.95 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|