C24H8F12N4Zn — CID 15907480
zinc 5,10,15,20-tetrakis(trifluoromethyl)porphyrin-22,24-diide (PubChem CID 15907480) has the molecular formula C24H8F12N4Zn and a molecular weight of 645.72 g/mol. Its IUPAC name is zinc 5,10,15,20-tetrakis(trifluoromethyl)porphyrin-22,24-diide.
| Compound Name | zinc 5,10,15,20-tetrakis(trifluoromethyl)porphyrin-22,24-diide |
|---|---|
| PubChem CID | 15907480 |
| Molecular Formula | C24H8F12N4Zn |
| Molecular Weight | 645.72 g/mol |
| Exact Mass | 643.98 |
| IUPAC Name | zinc 5,10,15,20-tetrakis(trifluoromethyl)porphyrin-22,24-diide |
| SMILES | FC(F)(F)c1c2nc(c(C(F)(F)F)c3ccc([n-]3)c(C(F)(F)F)c3nc(c(C(F)(F)F)c4ccc1[n-]4)C=C3)C=C2.[Zn+2] |
| InChI | InChI=1S/C24H8F12N4.Zn/c25-21(26,27)17-9-1-2-10(37-9)18(22(28,29)30)12-5-6-14(39-12)20(24(34,35)36)16-8-7-15(40-16)19(23(31,32)33)13-4-3-11(17)38-13;/h1-8H;/q-2;+2/b17-9+,17-11+,18-10+,18-12+,19-13+,19-15+,20-14+,20-16+; |
| InChIKey | HVSFTYLFHSNRAZ-HQJDZOCDSA-N |
| XLogP | 7.99 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.72 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|