C38H11CoF15N4-4 — CID 22986605
carbanide;cobalt;5,10,15-tris(2,3,4,5,6-pentafluorophenyl)corrin-21,23,24-triide (PubChem CID 22986605) has the molecular formula C38H11CoF15N4-4 and a molecular weight of 867.44 g/mol. Its IUPAC name is carbanide;cobalt;5,10,15-tris(2,3,4,5,6-pentafluorophenyl)corrin-21,23,24-triide.
| Compound Name | carbanide;cobalt;5,10,15-tris(2,3,4,5,6-pentafluorophenyl)corrin-21,23,24-triide |
|---|---|
| PubChem CID | 22986605 |
| Molecular Formula | C38H11CoF15N4-4 |
| Molecular Weight | 867.44 g/mol |
| Exact Mass | 867.01 |
| IUPAC Name | carbanide;cobalt;5,10,15-tris(2,3,4,5,6-pentafluorophenyl)corrin-21,23,24-triide |
| SMILES | Fc1c(F)c(F)c(-c2c3nc(c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc([n-]4)c4ccc([n-]4)c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc2[n-]4)C=C3)c(F)c1F.[CH3-].[Co] |
| InChI | InChI=1S/C37H8F15N4.CH3.Co/c38-23-20(24(39)30(45)35(50)29(23)44)17-11-3-1-9(53-11)10-2-4-12(54-10)18(21-25(40)31(46)36(51)32(47)26(21)41)14-6-8-16(56-14)19(15-7-5-13(17)55-15)22-27(42)33(48)37(52)34(49)28(22)43;;/h1-8H;1H3;/q-3;-1;/b10-9-,17-11+,17-13+,18-12+,18-14+,19-15+,19-16+;; |
| InChIKey | IPVGYOJQXMRILI-XDBICYDFSA-N |
| XLogP | 11.12 |
| TPSA | 55.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.44 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|