C44H20Cl8N4Pt — CID 177026078
platinum(2+);5,10,15,20-tetrakis(2,6-dichlorophenyl)porphyrin-22,24-diide (PubChem CID 177026078) has the molecular formula C44H20Cl8N4Pt and a molecular weight of 1083.37 g/mol. Its IUPAC name is platinum(2+);5,10,15,20-tetrakis(2,6-dichlorophenyl)porphyrin-22,24-diide.
| Compound Name | platinum(2+);5,10,15,20-tetrakis(2,6-dichlorophenyl)porphyrin-22,24-diide |
|---|---|
| PubChem CID | 177026078 |
| Molecular Formula | C44H20Cl8N4Pt |
| Molecular Weight | 1083.37 g/mol |
| Exact Mass | 1078.88 |
| IUPAC Name | platinum(2+);5,10,15,20-tetrakis(2,6-dichlorophenyl)porphyrin-22,24-diide |
| SMILES | Clc1cccc(Cl)c1-c1c2nc(c(-c3c(Cl)cccc3Cl)c3ccc([n-]3)c(-c3c(Cl)cccc3Cl)c3nc(c(-c4c(Cl)cccc4Cl)c4ccc1[n-]4)C=C3)C=C2.[Pt+2] |
| InChI | InChI=1S/C44H20Cl8N4.Pt/c45-21-5-1-6-22(46)37(21)41-29-13-15-31(53-29)42(38-23(47)7-2-8-24(38)48)33-17-19-35(55-33)44(40-27(51)11-4-12-28(40)52)36-20-18-34(56-36)43(32-16-14-30(41)54-32)39-25(49)9-3-10-26(39)50;/h1-20H;/q-2;+2/b41-29+,41-30+,42-31+,42-33+,43-32+,43-34+,44-35+,44-36+; |
| InChIKey | FTDGQVKNMRZVMR-AQZHRKEBSA-N |
| XLogP | 15.81 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1083.37 |
| LogP ≤ 5 | 15.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |