C40H29F6IN4O2SiZn — CID 11803926
zinc 2-trimethylsilylethyl 4-[15-(4-iodophenyl)-10,20-bis(trifluoromethyl)porphyrin-22,24-diid-5-yl]benzoate (PubChem CID 11803926) has the molecular formula C40H29F6IN4O2SiZn and a molecular weight of 932.07 g/mol. Its IUPAC name is zinc 2-trimethylsilylethyl 4-[15-(4-iodophenyl)-10,20-bis(trifluoromethyl)porphyrin-22,24-diid-5-yl]benzoate.
| Compound Name | zinc 2-trimethylsilylethyl 4-[15-(4-iodophenyl)-10,20-bis(trifluoromethyl)porphyrin-22,24-diid-5-yl]benzoate |
|---|---|
| PubChem CID | 11803926 |
| Molecular Formula | C40H29F6IN4O2SiZn |
| Molecular Weight | 932.07 g/mol |
| Exact Mass | 930.03 |
| IUPAC Name | zinc 2-trimethylsilylethyl 4-[15-(4-iodophenyl)-10,20-bis(trifluoromethyl)porphyrin-22,24-diid-5-yl]benzoate |
| SMILES | C[Si](C)(C)CCOC(=O)c1ccc(-c2c3nc(c(C(F)(F)F)c4ccc([n-]4)c(-c4ccc(I)cc4)c4nc(c(C(F)(F)F)c5ccc2[n-]5)C=C4)C=C3)cc1.[Zn+2] |
| InChI | InChI=1S/C40H30F6IN4O2Si.Zn/c1-54(2,3)21-20-53-38(52)24-6-4-22(5-7-24)34-26-12-16-30(48-26)36(39(41,42)43)32-18-14-28(50-32)35(23-8-10-25(47)11-9-23)29-15-19-33(51-29)37(40(44,45)46)31-17-13-27(34)49-31;/h4-19H,20-21H2,1-3H3,(H-,48,49,50,51,52);/q-1;+2/p-1/b34-26-,34-27-,35-28-,35-29-,36-30+,36-32+,37-31+,37-33+; |
| InChIKey | YVSZWMUPYUWCLH-FTKRQPLTSA-M |
| XLogP | 11.38 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.07 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|