C34H22N4O4 — CID 175941388
2-[10-(2-carboxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid (PubChem CID 175941388) has the molecular formula C34H22N4O4 and a molecular weight of 550.57 g/mol. Its IUPAC name is 2-[10-(2-carboxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid.
| Compound Name | 2-[10-(2-carboxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 175941388 |
| Molecular Formula | C34H22N4O4 |
| Molecular Weight | 550.57 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | 2-[10-(2-carboxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1c2nc(c(-c3ccccc3C(=O)O)c3ccc(cc4nc(cc5ccc1[nH]5)C=C4)[nH]3)C=C2 |
| InChI | InChI=1S/C34H22N4O4/c39-33(40)25-7-3-1-5-23(25)31-27-13-11-21(36-27)17-19-9-10-20(35-19)18-22-12-14-28(37-22)32(30-16-15-29(31)38-30)24-6-2-4-8-26(24)34(41)42/h1-18,36-37H,(H,39,40)(H,41,42)/b19-17-,20-18-,21-17-,22-18-,31-27-,31-29-,32-28-,32-30- |
| InChIKey | UXTLDEVPBSDQKP-IMVWINNQSA-N |
| XLogP | 7.39 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.57 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |