C43H32N4O3 — CID 101051653
6-(2,5-dimethoxyphenyl)-15,20-diphenyl-25-oxa-24,26,27,28-tetrazahexacyclo[19.2.1.12,5.17,10.111,14.116,19]octacosa-1,3,5,7(27),8,10,12,14,16,18,20,22-dodecaene (PubChem CID 101051653) has the molecular formula C43H32N4O3 and a molecular weight of 652.75 g/mol. Its IUPAC name is 6-(2,5-dimethoxyphenyl)-15,20-diphenyl-25-oxa-24,26,27,28-tetrazahexacyclo[19.2.1.12,5.17,10.111,14.116,19]octacosa-1,3,5,7(27),8,10,12,14,16,18,20,22-dodecaene.
| Compound Name | 6-(2,5-dimethoxyphenyl)-15,20-diphenyl-25-oxa-24,26,27,28-tetrazahexacyclo[19.2.1.12,5.17,10.111,14.116,19]octacosa-1,3,5,7(27),8,10,12,14,16,18,20,22-dodecaene |
|---|---|
| PubChem CID | 101051653 |
| Molecular Formula | C43H32N4O3 |
| Molecular Weight | 652.75 g/mol |
| Exact Mass | 652.25 |
| IUPAC Name | 6-(2,5-dimethoxyphenyl)-15,20-diphenyl-25-oxa-24,26,27,28-tetrazahexacyclo[19.2.1.12,5.17,10.111,14.116,19]octacosa-1,3,5,7(27),8,10,12,14,16,18,20,22-dodecaene |
| SMILES | COc1ccc(OC)c(-c2c3nc(c4ccc([nH]4)c(-c4ccccc4)c4ccc(o4)c(-c4ccccc4)c4ccc([nH]4)c4ccc2[nH]4)C=C3)c1 |
| InChI | InChI=1S/C43H32N4O3/c1-48-28-13-22-38(49-2)29(25-28)43-36-20-16-32(46-36)30-14-18-34(44-30)41(26-9-5-3-6-10-26)39-23-24-40(50-39)42(27-11-7-4-8-12-27)35-19-15-31(45-35)33-17-21-37(43)47-33/h3-25,44-46H,1-2H3/b32-30-,33-31-,41-34-,41-39-,42-35-,42-40-,43-36-,43-37- |
| InChIKey | AIXYWUIXGIRSNN-ATAAXGCASA-N |
| XLogP | 11.02 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.75 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |