C48H31N3O2 — CID 10770836
6,11,16,21-tetraphenyl-26,28-dioxa-25,27,29-triazahexacyclo[20.2.1.12,5.17,10.112,15.117,20]nonacosa-1,3,5,7,9,11,13,15(27),16,18,20,22(25),23-tridecaene (PubChem CID 10770836) has the molecular formula C48H31N3O2 and a molecular weight of 681.80 g/mol. Its IUPAC name is 6,11,16,21-tetraphenyl-26,28-dioxa-25,27,29-triazahexacyclo[20.2.1.12,5.17,10.112,15.117,20]nonacosa-1,3,5,7,9,11,13,15(27),16,18,20,22(25),23-tridecaene.
| Compound Name | 6,11,16,21-tetraphenyl-26,28-dioxa-25,27,29-triazahexacyclo[20.2.1.12,5.17,10.112,15.117,20]nonacosa-1,3,5,7,9,11,13,15(27),16,18,20,22(25),23-tridecaene |
|---|---|
| PubChem CID | 10770836 |
| Molecular Formula | C48H31N3O2 |
| Molecular Weight | 681.80 g/mol |
| Exact Mass | 681.24 |
| IUPAC Name | 6,11,16,21-tetraphenyl-26,28-dioxa-25,27,29-triazahexacyclo[20.2.1.12,5.17,10.112,15.117,20]nonacosa-1,3,5,7,9,11,13,15(27),16,18,20,22(25),23-tridecaene |
| SMILES | C1=Cc2nc1c(-c1ccccc1)c1ccc(o1)c(-c1ccccc1)c1nc(c3ccc([nH]3)c(-c3ccccc3)c3ccc(o3)c2-c2ccccc2)C=C1 |
| InChI | InChI=1S/C48H31N3O2/c1-5-13-31(14-6-1)45-37-23-21-35(49-37)36-22-24-38(50-36)46(32-15-7-2-8-16-32)42-28-30-44(53-42)48(34-19-11-4-12-20-34)40-26-25-39(51-40)47(33-17-9-3-10-18-33)43-29-27-41(45)52-43/h1-30,49H/b36-35-,45-37-,45-41-,46-38-,46-42-,47-39-,47-43-,48-40-,48-44- |
| InChIKey | PRKXBOAQTZHKDW-QNJFGUTCSA-N |
| XLogP | 12.90 |
| TPSA | 67.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.80 |
| LogP ≤ 5 | 12.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |