C58H46N4O6 — CID 136832905
5-anthracen-9-yl-10,15,20-tris(3,5-dimethoxyphenyl)-21,23-dihydroporphyrin (PubChem CID 136832905) has the molecular formula C58H46N4O6 and a molecular weight of 895.03 g/mol. Its IUPAC name is 5-anthracen-9-yl-10,15,20-tris(3,5-dimethoxyphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5-anthracen-9-yl-10,15,20-tris(3,5-dimethoxyphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136832905 |
| Molecular Formula | C58H46N4O6 |
| Molecular Weight | 895.03 g/mol |
| Exact Mass | 894.34 |
| IUPAC Name | 5-anthracen-9-yl-10,15,20-tris(3,5-dimethoxyphenyl)-21,23-dihydroporphyrin |
| SMILES | COc1cc(OC)cc(-c2c3nc(c(-c4cc(OC)cc(OC)c4)c4ccc([nH]4)c(-c4c5ccccc5cc5ccccc45)c4nc(c(-c5cc(OC)cc(OC)c5)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C58H46N4O6/c1-63-38-24-35(25-39(30-38)64-2)54-46-15-17-48(59-46)55(36-26-40(65-3)31-41(27-36)66-4)50-19-21-52(61-50)58(57-44-13-9-7-11-33(44)23-34-12-8-10-14-45(34)57)53-22-20-51(62-53)56(49-18-16-47(54)60-49)37-28-42(67-5)32-43(29-37)68-6/h7-32,59,62H,1-6H3/b54-46-,54-47-,55-48-,55-50-,56-49-,56-51-,58-52+,58-53+ |
| InChIKey | CZLGNZJUSMVPIL-HDYAKJHFSA-N |
| XLogP | 13.68 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.03 |
| LogP ≤ 5 | 13.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|