C47H36FeN4O4 — CID 175729519
iron;4-[10,15,20-tris(4-methoxyphenyl)-21,23-dihydroporphyrin-5-yl]phenol (PubChem CID 175729519) has the molecular formula C47H36FeN4O4 and a molecular weight of 776.67 g/mol. Its IUPAC name is iron;4-[10,15,20-tris(4-methoxyphenyl)-21,23-dihydroporphyrin-5-yl]phenol.
| Compound Name | iron;4-[10,15,20-tris(4-methoxyphenyl)-21,23-dihydroporphyrin-5-yl]phenol |
|---|---|
| PubChem CID | 175729519 |
| Molecular Formula | C47H36FeN4O4 |
| Molecular Weight | 776.67 g/mol |
| Exact Mass | 776.21 |
| IUPAC Name | iron;4-[10,15,20-tris(4-methoxyphenyl)-21,23-dihydroporphyrin-5-yl]phenol |
| SMILES | COc1ccc(-c2c3nc(c(-c4ccc(OC)cc4)c4ccc([nH]4)c(-c4ccc(OC)cc4)c4nc(c(-c5ccc(O)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1.[Fe] |
| InChI | InChI=1S/C47H36N4O4.Fe/c1-53-33-14-6-29(7-15-33)45-38-22-20-36(48-38)44(28-4-12-32(52)13-5-28)37-21-23-39(49-37)46(30-8-16-34(54-2)17-9-30)41-25-27-43(51-41)47(42-26-24-40(45)50-42)31-10-18-35(55-3)19-11-31;/h4-27,48,51-52H,1-3H3;/b44-36-,44-37-,45-38-,45-40-,46-39-,46-41-,47-42-,47-43-; |
| InChIKey | QXLFBUXTXOJDEF-RUNSENEXSA-N |
| XLogP | 11.05 |
| TPSA | 105.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.67 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|