C48H35N5O3S — CID 136748465
5-(4-isothiocyanatophenyl)-10,15,20-tris(4-methoxyphenyl)-21,23-dihydroporphyrin (PubChem CID 136748465) has the molecular formula C48H35N5O3S and a molecular weight of 761.91 g/mol. Its IUPAC name is 5-(4-isothiocyanatophenyl)-10,15,20-tris(4-methoxyphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5-(4-isothiocyanatophenyl)-10,15,20-tris(4-methoxyphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136748465 |
| Molecular Formula | C48H35N5O3S |
| Molecular Weight | 761.91 g/mol |
| Exact Mass | 761.25 |
| IUPAC Name | 5-(4-isothiocyanatophenyl)-10,15,20-tris(4-methoxyphenyl)-21,23-dihydroporphyrin |
| SMILES | COc1ccc(-c2c3nc(c(-c4ccc(OC)cc4)c4ccc([nH]4)c(-c4ccc(OC)cc4)c4nc(c(-c5ccc(N=C=S)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C48H35N5O3S/c1-54-34-14-6-30(7-15-34)46-39-22-20-37(50-39)45(29-4-12-33(13-5-29)49-28-57)38-21-23-40(51-38)47(31-8-16-35(55-2)17-9-31)42-25-27-44(53-42)48(43-26-24-41(46)52-43)32-10-18-36(56-3)19-11-32/h4-27,50,53H,1-3H3/b45-37-,45-38-,46-39-,46-41-,47-40-,47-42-,48-43-,48-44- |
| InChIKey | CIQREUZTNWEMIG-PJEPRTEXSA-N |
| XLogP | 12.08 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.91 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|