C47H35FN4O — CID 135447688
5-(4-fluoro-3-methylphenyl)-10-(4-methoxyphenyl)-15-(4-methylphenyl)-20-phenyl-21,23-dihydroporphyrin (PubChem CID 135447688) has the molecular formula C47H35FN4O and a molecular weight of 690.82 g/mol. Its IUPAC name is 5-(4-fluoro-3-methylphenyl)-10-(4-methoxyphenyl)-15-(4-methylphenyl)-20-phenyl-21,23-dihydroporphyrin.
| Compound Name | 5-(4-fluoro-3-methylphenyl)-10-(4-methoxyphenyl)-15-(4-methylphenyl)-20-phenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135447688 |
| Molecular Formula | C47H35FN4O |
| Molecular Weight | 690.82 g/mol |
| Exact Mass | 690.28 |
| IUPAC Name | 5-(4-fluoro-3-methylphenyl)-10-(4-methoxyphenyl)-15-(4-methylphenyl)-20-phenyl-21,23-dihydroporphyrin |
| SMILES | COc1ccc(-c2c3nc(c(-c4ccc(F)c(C)c4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccc(C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C47H35FN4O/c1-28-9-11-31(12-10-28)45-38-20-19-36(49-38)44(30-7-5-4-6-8-30)37-23-25-42(51-37)47(33-15-18-35(48)29(2)27-33)43-26-24-41(52-43)46(40-22-21-39(45)50-40)32-13-16-34(53-3)17-14-32/h4-27,50-51H,1-3H3/b44-36-,44-37-,45-38-,45-39-,46-40-,46-41-,47-42-,47-43- |
| InChIKey | YPJQQUQXHMWACC-YPSDBIFCSA-N |
| XLogP | 12.09 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.82 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |