C7H4Br2F2S — CID 130862936
1,5-dibromo-2,3-difluoro-4-methylsulfanylbenzene (PubChem CID 130862936) has the molecular formula C7H4Br2F2S and a molecular weight of 317.98 g/mol. Its IUPAC name is 1,5-dibromo-2,3-difluoro-4-methylsulfanylbenzene.
| Compound Name | 1,5-dibromo-2,3-difluoro-4-methylsulfanylbenzene |
|---|---|
| PubChem CID | 130862936 |
| Molecular Formula | C7H4Br2F2S |
| Molecular Weight | 317.98 g/mol |
| Exact Mass | 315.84 |
| IUPAC Name | 1,5-dibromo-2,3-difluoro-4-methylsulfanylbenzene |
| SMILES | CSc1c(Br)cc(Br)c(F)c1F |
| InChI | InChI=1S/C7H4Br2F2S/c1-12-7-4(9)2-3(8)5(10)6(7)11/h2H,1H3 |
| InChIKey | NIHDKDOZUKYMHW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.98 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|